C25H29NO6 — CID 46889686
(5Z)-5-[(1S,4R)-9-[(1E,3E,5E)-7-hydroxyhepta-1,3,5-trienyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one (PubChem CID 46889686) has the molecular formula C25H29NO6 and a molecular weight of 439.51 g/mol. Its IUPAC name is (5Z)-5-[(1S,4R)-9-[(1E,3E,5E)-7-hydroxyhepta-1,3,5-trienyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one.
| Compound Name | (5Z)-5-[(1S,4R)-9-[(1E,3E,5E)-7-hydroxyhepta-1,3,5-trienyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
|---|---|
| PubChem CID | 46889686 |
| Molecular Formula | C25H29NO6 |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | (5Z)-5-[(1S,4R)-9-[(1E,3E,5E)-7-hydroxyhepta-1,3,5-trienyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
| SMILES | COC1=C(C)C(=O)O/C1=C1\OC23OC4CC(C2C1C)N1CCC3C41/C=C/C=C/C=C/CO |
| InChI | InChI=1S/C25H29NO6/c1-14-19-16-13-18-24(10-7-5-4-6-8-12-27)17(9-11-26(16)24)25(19,31-18)32-21(14)22-20(29-3)15(2)23(28)30-22/h4-8,10,14,16-19,27H,9,11-13H2,1-3H3/b5-4+,8-6+,10-7+,22-21- |
| InChIKey | YLAGUKSDJBZKIZ-AYDJKWLESA-N |
| XLogP | 2.56 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|