C23H27NO6 — CID 46889687
(5Z)-5-[(1S,4R)-9-[(1E,3E)-5-hydroxypenta-1,3-dienyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one (PubChem CID 46889687) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (5Z)-5-[(1S,4R)-9-[(1E,3E)-5-hydroxypenta-1,3-dienyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one.
| Compound Name | (5Z)-5-[(1S,4R)-9-[(1E,3E)-5-hydroxypenta-1,3-dienyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
|---|---|
| PubChem CID | 46889687 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (5Z)-5-[(1S,4R)-9-[(1E,3E)-5-hydroxypenta-1,3-dienyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
| SMILES | COC1=C(C)C(=O)O/C1=C1\OC23OC4CC(C2C1C)N1CCC3C41/C=C/C=C/CO |
| InChI | InChI=1S/C23H27NO6/c1-12-17-14-11-16-22(8-5-4-6-10-25)15(7-9-24(14)22)23(17,29-16)30-19(12)20-18(27-3)13(2)21(26)28-20/h4-6,8,12,14-17,25H,7,9-11H2,1-3H3/b6-4+,8-5+,20-19- |
| InChIKey | INGCLLMQGYHZLU-VAFYZIIJSA-N |
| XLogP | 2.00 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|