C22H27NO6 — CID 46889721
(5Z)-5-[(1S,4R)-9-[(1R)-1-hydroxybut-3-enyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one (PubChem CID 46889721) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is (5Z)-5-[(1S,4R)-9-[(1R)-1-hydroxybut-3-enyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one.
| Compound Name | (5Z)-5-[(1S,4R)-9-[(1R)-1-hydroxybut-3-enyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
|---|---|
| PubChem CID | 46889721 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | (5Z)-5-[(1S,4R)-9-[(1R)-1-hydroxybut-3-enyl]-4-methyl-2,14-dioxa-10-azapentacyclo[6.5.1.01,5.06,10.09,13]tetradecan-3-ylidene]-4-methoxy-3-methylfuran-2-one |
| SMILES | C=CC[C@@H](O)C12C3CC4C5C(C)/C(=C6/OC(=O)C(C)=C6OC)OC5(O3)C1CCN42 |
| InChI | InChI=1S/C22H27NO6/c1-5-6-14(24)21-13-7-8-23(21)12-9-15(21)28-22(13)16(12)10(2)18(29-22)19-17(26-4)11(3)20(25)27-19/h5,10,12-16,24H,1,6-9H2,2-4H3/b19-18-/t10?,12?,13?,14-,15?,16?,21?,22?/m1/s1 |
| InChIKey | JSWHBVQUNCYCQO-PUVVSVFWSA-N |
| XLogP | 1.84 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|