C24H43N3O4 — CID 46889725
(E,4S)-4-[[(2S)-2-[2-(cyclohexylamino)propanoylamino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid (PubChem CID 46889725) has the molecular formula C24H43N3O4 and a molecular weight of 437.63 g/mol. Its IUPAC name is (E,4S)-4-[[(2S)-2-[2-(cyclohexylamino)propanoylamino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid.
| Compound Name | (E,4S)-4-[[(2S)-2-[2-(cyclohexylamino)propanoylamino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
|---|---|
| PubChem CID | 46889725 |
| Molecular Formula | C24H43N3O4 |
| Molecular Weight | 437.63 g/mol |
| Exact Mass | 437.33 |
| IUPAC Name | (E,4S)-4-[[(2S)-2-[2-(cyclohexylamino)propanoylamino]-3,3-dimethylbutanoyl]-methylamino]-2,5-dimethylhex-2-enoic acid |
| SMILES | C/C(=C\[C@H](C(C)C)N(C)C(=O)[C@@H](NC(=O)C(C)NC1CCCCC1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C24H43N3O4/c1-15(2)19(14-16(3)23(30)31)27(8)22(29)20(24(5,6)7)26-21(28)17(4)25-18-12-10-9-11-13-18/h14-15,17-20,25H,9-13H2,1-8H3,(H,26,28)(H,30,31)/b16-14+/t17?,19-,20-/m1/s1 |
| InChIKey | JZYDUWOBEJAQEF-GMSJIDIYSA-N |
| XLogP | 3.34 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.63 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|