C22H22ClN3O5 — CID 46889732
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(6-pyridin-3-ylpyridazin-3-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46889732) has the molecular formula C22H22ClN3O5 and a molecular weight of 443.89 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(6-pyridin-3-ylpyridazin-3-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(6-pyridin-3-ylpyridazin-3-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46889732 |
| Molecular Formula | C22H22ClN3O5 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(6-pyridin-3-ylpyridazin-3-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(-c4cccnc4)nn3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H22ClN3O5/c23-16-5-3-12(22-21(30)20(29)19(28)18(11-27)31-22)8-14(16)9-15-4-6-17(26-25-15)13-2-1-7-24-10-13/h1-8,10,18-22,27-30H,9,11H2/t18-,19-,20+,21-,22+/m1/s1 |
| InChIKey | SDRMUEBOQBGYMX-BDHVOXNPSA-N |
| XLogP | 1.30 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |