C21H26ClN3O6 — CID 46889775
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(6-morpholin-4-ylpyridazin-3-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 46889775) has the molecular formula C21H26ClN3O6 and a molecular weight of 451.91 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(6-morpholin-4-ylpyridazin-3-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(6-morpholin-4-ylpyridazin-3-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46889775 |
| Molecular Formula | C21H26ClN3O6 |
| Molecular Weight | 451.91 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(6-morpholin-4-ylpyridazin-3-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ccc(N4CCOCC4)nn3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H26ClN3O6/c22-15-3-1-12(21-20(29)19(28)18(27)16(11-26)31-21)9-13(15)10-14-2-4-17(24-23-14)25-5-7-30-8-6-25/h1-4,9,16,18-21,26-29H,5-8,10-11H2/t16-,18-,19+,20-,21+/m1/s1 |
| InChIKey | YVFVVRMUAZLTFC-RQXATKFSSA-N |
| XLogP | 0.07 |
| TPSA | 128.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.91 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |