About 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine
1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine (PubChem CID 46889842) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine |
| PubChem CID | 46889842 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine |
| SMILES | CC1(C)CCCN1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H19NO2/c1-14(2)6-3-7-15(14)9-11-4-5-12-13(8-11)17-10-16-12/h4-5,8H,3,6-7,9-10H2,1-2H3 |
| InChIKey | MGLAVOWIBYVMLI-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine?
The IUPAC name of 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine (CID 46889842) is 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine.
What is the SMILES notation for 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine?
The canonical SMILES for 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine is CC1(C)CCCN1Cc1ccc2c(c1)OCO2.
What is the InChIKey of 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine?
The InChIKey is MGLAVOWIBYVMLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-14(2)6-3-7-15(14)9-11-4-5-12-13(8-11)17-10-16-12/h4-5,8H,3,6-7,9-10H2,1-2H3.
What are the key properties of 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine?
1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine has a molecular weight of 233.31 g/mol, XLogP of 2.79, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-ylmethyl)-2,2-dimethylpyrrolidine is sourced from PubChem (CID 46889842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).