C18H20N2O3S — CID 46889858
[6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methylurea (PubChem CID 46889858) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is [6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methylurea.
| Compound Name | [6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methylurea |
|---|---|
| PubChem CID | 46889858 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [6-(benzenesulfonyl)-1,2,3,4-tetrahydronaphthalen-1-yl]methylurea |
| SMILES | NC(=O)NCC1CCCc2cc(S(=O)(=O)c3ccccc3)ccc21 |
| InChI | InChI=1S/C18H20N2O3S/c19-18(21)20-12-14-6-4-5-13-11-16(9-10-17(13)14)24(22,23)15-7-2-1-3-8-15/h1-3,7-11,14H,4-6,12H2,(H3,19,20,21) |
| InChIKey | GAHMIXAUEZAMRF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |