C14H17NO3 — CID 46889877
7-(1,3-benzodioxol-5-ylmethyl)-2-oxa-7-azaspiro[3.4]octane (PubChem CID 46889877) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is 7-(1,3-benzodioxol-5-ylmethyl)-2-oxa-7-azaspiro[3.4]octane.
| Compound Name | 7-(1,3-benzodioxol-5-ylmethyl)-2-oxa-7-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 46889877 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 7-(1,3-benzodioxol-5-ylmethyl)-2-oxa-7-azaspiro[3.4]octane |
| SMILES | c1cc2c(cc1CN1CCC3(COC3)C1)OCO2 |
| InChI | InChI=1S/C14H17NO3/c1-2-12-13(18-10-17-12)5-11(1)6-15-4-3-14(7-15)8-16-9-14/h1-2,5H,3-4,6-10H2 |
| InChIKey | HAJGXHSXNVUZJG-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |