C18H21NO2S — CID 46889915
[(1R)-6-benzylsulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine (PubChem CID 46889915) has the molecular formula C18H21NO2S and a molecular weight of 315.44 g/mol. Its IUPAC name is [(1R)-6-benzylsulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine.
| Compound Name | [(1R)-6-benzylsulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine |
|---|---|
| PubChem CID | 46889915 |
| Molecular Formula | C18H21NO2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [(1R)-6-benzylsulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methanamine |
| SMILES | NC[C@@H]1CCCc2cc(S(=O)(=O)Cc3ccccc3)ccc21 |
| InChI | InChI=1S/C18H21NO2S/c19-12-16-8-4-7-15-11-17(9-10-18(15)16)22(20,21)13-14-5-2-1-3-6-14/h1-3,5-6,9-11,16H,4,7-8,12-13,19H2/t16-/m0/s1 |
| InChIKey | XCWIADZUHWFIDZ-INIZCTEOSA-N |
| XLogP | 3.04 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |