C15H29N7O4 — CID 46889986
(2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]pentanamide (PubChem CID 46889986) has the molecular formula C15H29N7O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 46889986 |
| Molecular Formula | C15H29N7O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.23 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamidopropanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-1-(methylamino)-1-oxopropan-2-yl]pentanamide |
| SMILES | CNC(=O)[C@H](C)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](C)NC(C)=O |
| InChI | InChI=1S/C15H29N7O4/c1-8(12(24)18-4)21-14(26)11(6-5-7-19-15(16)17)22-13(25)9(2)20-10(3)23/h8-9,11H,5-7H2,1-4H3,(H,18,24)(H,20,23)(H,21,26)(H,22,25)(H4,16,17,19)/t8-,9-,11-/m0/s1 |
| InChIKey | PYWIZEZTCCLSTR-QXEWZRGKSA-N |
| XLogP | -2.70 |
| TPSA | 180.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|