About [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid
[3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid (PubChem CID 46890018) has the molecular formula C11H13BN2O5S
and a molecular weight of 296.11 g/mol. Its IUPAC name is [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid.
Molecular Properties
| Compound Name | [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid |
| PubChem CID | 46890018 |
| Molecular Formula | C11H13BN2O5S |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid |
| SMILES | Cc1noc(C)c1S(=O)(=O)Nc1cccc(B(O)O)c1 |
| InChI | InChI=1S/C11H13BN2O5S/c1-7-11(8(2)19-13-7)20(17,18)14-10-5-3-4-9(6-10)12(15)16/h3-6,14-16H,1-2H3 |
| InChIKey | CRVGAEIHZPNGBB-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 112.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid?
The IUPAC name of [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid (CID 46890018) is [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid.
What is the SMILES notation for [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid?
The canonical SMILES for [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid is Cc1noc(C)c1S(=O)(=O)Nc1cccc(B(O)O)c1.
What is the InChIKey of [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid?
The InChIKey is CRVGAEIHZPNGBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BN2O5S/c1-7-11(8(2)19-13-7)20(17,18)14-10-5-3-4-9(6-10)12(15)16/h3-6,14-16H,1-2H3.
What are the key properties of [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid?
[3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid has a molecular weight of 296.11 g/mol, XLogP of -0.23, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]phenyl]boronic acid is sourced from PubChem (CID 46890018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).