C18H15FN2O4S — CID 46890030
2-[3-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-3-yl)-5-fluoro-2-methylindol-1-yl]acetic acid (PubChem CID 46890030) has the molecular formula C18H15FN2O4S and a molecular weight of 374.39 g/mol. Its IUPAC name is 2-[3-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-3-yl)-5-fluoro-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-3-yl)-5-fluoro-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 46890030 |
| Molecular Formula | C18H15FN2O4S |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | 2-[3-(1,1-dioxo-2,3-dihydro-1,2-benzothiazol-3-yl)-5-fluoro-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(C2NS(=O)(=O)c3ccccc32)c2cc(F)ccc2n1CC(=O)O |
| InChI | InChI=1S/C18H15FN2O4S/c1-10-17(18-12-4-2-3-5-15(12)26(24,25)20-18)13-8-11(19)6-7-14(13)21(10)9-16(22)23/h2-8,18,20H,9H2,1H3,(H,22,23) |
| InChIKey | ULJBQIKLGBOHGM-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|