C21H22N2O4S — CID 46890134
2-[3-(1,1-dioxo-2-propan-2-yl-3H-1,2-benzothiazol-3-yl)-2-methylindol-1-yl]acetic acid (PubChem CID 46890134) has the molecular formula C21H22N2O4S and a molecular weight of 398.48 g/mol. Its IUPAC name is 2-[3-(1,1-dioxo-2-propan-2-yl-3H-1,2-benzothiazol-3-yl)-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-(1,1-dioxo-2-propan-2-yl-3H-1,2-benzothiazol-3-yl)-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 46890134 |
| Molecular Formula | C21H22N2O4S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 2-[3-(1,1-dioxo-2-propan-2-yl-3H-1,2-benzothiazol-3-yl)-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(C2c3ccccc3S(=O)(=O)N2C(C)C)c2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C21H22N2O4S/c1-13(2)23-21(16-9-5-7-11-18(16)28(23,26)27)20-14(3)22(12-19(24)25)17-10-6-4-8-15(17)20/h4-11,13,21H,12H2,1-3H3,(H,24,25) |
| InChIKey | MOGHOFHTUCEXJL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|