C24H20N2O4S — CID 46890135
2-[3-(1,1-dioxo-2-phenyl-3H-1,2-benzothiazol-3-yl)-2-methylindol-1-yl]acetic acid (PubChem CID 46890135) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-[3-(1,1-dioxo-2-phenyl-3H-1,2-benzothiazol-3-yl)-2-methylindol-1-yl]acetic acid.
| Compound Name | 2-[3-(1,1-dioxo-2-phenyl-3H-1,2-benzothiazol-3-yl)-2-methylindol-1-yl]acetic acid |
|---|---|
| PubChem CID | 46890135 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | 2-[3-(1,1-dioxo-2-phenyl-3H-1,2-benzothiazol-3-yl)-2-methylindol-1-yl]acetic acid |
| SMILES | Cc1c(C2c3ccccc3S(=O)(=O)N2c2ccccc2)c2ccccc2n1CC(=O)O |
| InChI | InChI=1S/C24H20N2O4S/c1-16-23(18-11-5-7-13-20(18)25(16)15-22(27)28)24-19-12-6-8-14-21(19)31(29,30)26(24)17-9-3-2-4-10-17/h2-14,24H,15H2,1H3,(H,27,28) |
| InChIKey | JAXQBYVUYXMAES-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|