C18H17F4NO4S2 — CID 46890263
1,1,1-trifluoro-N-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]methanesulfonamide (PubChem CID 46890263) has the molecular formula C18H17F4NO4S2 and a molecular weight of 451.46 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 46890263 |
| Molecular Formula | C18H17F4NO4S2 |
| Molecular Weight | 451.46 g/mol |
| Exact Mass | 451.05 |
| IUPAC Name | 1,1,1-trifluoro-N-[[(1R)-6-(3-fluorophenyl)sulfonyl-1,2,3,4-tetrahydronaphthalen-1-yl]methyl]methanesulfonamide |
| SMILES | O=S(=O)(c1cccc(F)c1)c1ccc2c(c1)CCC[C@H]2CNS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H17F4NO4S2/c19-14-5-2-6-15(10-14)28(24,25)16-7-8-17-12(9-16)3-1-4-13(17)11-23-29(26,27)18(20,21)22/h2,5-10,13,23H,1,3-4,11H2/t13-/m0/s1 |
| InChIKey | DSLNKKPMYSKZHS-ZDUSSCGKSA-N |
| XLogP | 3.52 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |