About 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one
3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one (PubChem CID 46890469) has the molecular formula C17H14N4O3
and a molecular weight of 322.32 g/mol. Its IUPAC name is 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one.
Molecular Properties
| Compound Name | 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one |
| PubChem CID | 46890469 |
| Molecular Formula | C17H14N4O3 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one |
| SMILES | O=C(CCn1nnnc1-c1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C17H14N4O3/c22-14(12-4-2-1-3-5-12)8-9-21-17(18-19-20-21)13-6-7-15-16(10-13)24-11-23-15/h1-7,10H,8-9,11H2 |
| InChIKey | XZDUJYUYLDTLED-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one?
The IUPAC name of 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one (CID 46890469) is 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one.
What is the SMILES notation for 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one?
The canonical SMILES for 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one is O=C(CCn1nnnc1-c1ccc2c(c1)OCO2)c1ccccc1.
What is the InChIKey of 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one?
The InChIKey is XZDUJYUYLDTLED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N4O3/c22-14(12-4-2-1-3-5-12)8-9-21-17(18-19-20-21)13-6-7-15-16(10-13)24-11-23-15/h1-7,10H,8-9,11H2.
What are the key properties of 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one?
3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one has a molecular weight of 322.32 g/mol, XLogP of 2.34, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(1,3-benzodioxol-5-yl)tetrazol-1-yl]-1-phenylpropan-1-one is sourced from PubChem (CID 46890469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).