C14H18BrN3O4 — CID 46890584
3-bromo-N-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]benzamide (PubChem CID 46890584) has the molecular formula C14H18BrN3O4 and a molecular weight of 372.22 g/mol. Its IUPAC name is 3-bromo-N-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]benzamide.
| Compound Name | 3-bromo-N-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 46890584 |
| Molecular Formula | C14H18BrN3O4 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.05 |
| IUPAC Name | 3-bromo-N-[[6-(hydroxyamino)-6-oxohexyl]carbamoyl]benzamide |
| SMILES | O=C(CCCCCNC(=O)NC(=O)c1cccc(Br)c1)NO |
| InChI | InChI=1S/C14H18BrN3O4/c15-11-6-4-5-10(9-11)13(20)17-14(21)16-8-3-1-2-7-12(19)18-22/h4-6,9,22H,1-3,7-8H2,(H,18,19)(H2,16,17,20,21) |
| InChIKey | FKBINUQUENYAFV-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|