C25H20N6S — CID 46890746
6-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(naphthalen-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 46890746) has the molecular formula C25H20N6S and a molecular weight of 436.54 g/mol. Its IUPAC name is 6-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(naphthalen-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(naphthalen-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 46890746 |
| Molecular Formula | C25H20N6S |
| Molecular Weight | 436.54 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 6-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-3-(naphthalen-1-ylmethyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1cc(C)n(-c2ccc(-c3nn4c(Cc5cccc6ccccc56)nnc4s3)cc2)n1 |
| InChI | InChI=1S/C25H20N6S/c1-16-14-17(2)30(28-16)21-12-10-19(11-13-21)24-29-31-23(26-27-25(31)32-24)15-20-8-5-7-18-6-3-4-9-22(18)20/h3-14H,15H2,1-2H3 |
| InChIKey | RFBDRNPIHGLWOT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |