C20H15ClN6S — CID 46890794
3-(2-chlorophenyl)-6-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 46890794) has the molecular formula C20H15ClN6S and a molecular weight of 406.90 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-6-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-(2-chlorophenyl)-6-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 46890794 |
| Molecular Formula | C20H15ClN6S |
| Molecular Weight | 406.90 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | 3-(2-chlorophenyl)-6-[4-(3,5-dimethylpyrazol-1-yl)phenyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | Cc1cc(C)n(-c2ccc(-c3nn4c(-c5ccccc5Cl)nnc4s3)cc2)n1 |
| InChI | InChI=1S/C20H15ClN6S/c1-12-11-13(2)26(24-12)15-9-7-14(8-10-15)19-25-27-18(22-23-20(27)28-19)16-5-3-4-6-17(16)21/h3-11H,1-2H3 |
| InChIKey | UFABVFZXKPHPKZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.90 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |