C18H17F5N4O2S — CID 46890880
(4R,6S)-4,6-dicyclopropyl-7,7-difluoro-5-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4,6-dihydro-1H-pyrazolo[4,5-c]pyridine (PubChem CID 46890880) has the molecular formula C18H17F5N4O2S and a molecular weight of 448.42 g/mol. Its IUPAC name is (4R,6S)-4,6-dicyclopropyl-7,7-difluoro-5-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4,6-dihydro-1H-pyrazolo[4,5-c]pyridine.
| Compound Name | (4R,6S)-4,6-dicyclopropyl-7,7-difluoro-5-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4,6-dihydro-1H-pyrazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 46890880 |
| Molecular Formula | C18H17F5N4O2S |
| Molecular Weight | 448.42 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | (4R,6S)-4,6-dicyclopropyl-7,7-difluoro-5-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]-4,6-dihydro-1H-pyrazolo[4,5-c]pyridine |
| SMILES | O=S(=O)(c1ccc(C(F)(F)F)nc1)N1[C@@H](C2CC2)C(F)(F)c2[nH]ncc2[C@H]1C1CC1 |
| InChI | InChI=1S/C18H17F5N4O2S/c19-17(20)15-12(8-25-26-15)14(9-1-2-9)27(16(17)10-3-4-10)30(28,29)11-5-6-13(24-7-11)18(21,22)23/h5-10,14,16H,1-4H2,(H,25,26)/t14-,16+/m1/s1 |
| InChIKey | NXPQBVTVDAZRRT-ZBFHGGJFSA-N |
| XLogP | 3.85 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |