C27H26O5S — CID 46890905
(2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(trityloxymethyl)-2,5-dihydrofuran (PubChem CID 46890905) has the molecular formula C27H26O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(trityloxymethyl)-2,5-dihydrofuran.
| Compound Name | (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(trityloxymethyl)-2,5-dihydrofuran |
|---|---|
| PubChem CID | 46890905 |
| Molecular Formula | C27H26O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(trityloxymethyl)-2,5-dihydrofuran |
| SMILES | C=CS(=O)(=O)C1=C[C@@H](OC)O[C@@H]1COC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26O5S/c1-3-33(28,29)25-19-26(30-2)32-24(25)20-31-27(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23/h3-19,24,26H,1,20H2,2H3/t24-,26+/m1/s1 |
| InChIKey | NPQLFHMBMXACAQ-RSXGOPAZSA-N |
| XLogP | 4.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|