About (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran
(2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran (PubChem CID 46890957) has the molecular formula C15H18O5S
and a molecular weight of 310.37 g/mol. Its IUPAC name is (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran.
Molecular Properties
| Compound Name | (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran |
| PubChem CID | 46890957 |
| Molecular Formula | C15H18O5S |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran |
| SMILES | C=CS(=O)(=O)C1=C[C@@H](OC)O[C@@H]1COCc1ccccc1 |
| InChI | InChI=1S/C15H18O5S/c1-3-21(16,17)14-9-15(18-2)20-13(14)11-19-10-12-7-5-4-6-8-12/h3-9,13,15H,1,10-11H2,2H3/t13-,15+/m1/s1 |
| InChIKey | BAXFELSGNNLVRE-HIFRSBDPSA-N |
| XLogP | 2.02 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran?
The IUPAC name of (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran (CID 46890957) is (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran.
What is the SMILES notation for (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran?
The canonical SMILES for (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran is C=CS(=O)(=O)C1=C[C@@H](OC)O[C@@H]1COCc1ccccc1.
What is the InChIKey of (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran?
The InChIKey is BAXFELSGNNLVRE-HIFRSBDPSA-N. The full InChI is InChI=1S/C15H18O5S/c1-3-21(16,17)14-9-15(18-2)20-13(14)11-19-10-12-7-5-4-6-8-12/h3-9,13,15H,1,10-11H2,2H3/t13-,15+/m1/s1.
What are the key properties of (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran?
(2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran has a molecular weight of 310.37 g/mol, XLogP of 2.02, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5S)-3-ethenylsulfonyl-5-methoxy-2-(phenylmethoxymethyl)-2,5-dihydrofuran is sourced from PubChem (CID 46890957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).