About [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone
[4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone (PubChem CID 46890991) has the molecular formula C25H20Cl2N4O
and a molecular weight of 463.37 g/mol. Its IUPAC name is [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone.
Molecular Properties
| Compound Name | [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone |
| PubChem CID | 46890991 |
| Molecular Formula | C25H20Cl2N4O |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(c2nnc(-c3ccc(Cl)c(Cl)c3)c3ccccc23)CC1 |
| InChI | InChI=1S/C25H20Cl2N4O/c26-21-11-10-18(16-22(21)27)23-19-8-4-5-9-20(19)24(29-28-23)30-12-14-31(15-13-30)25(32)17-6-2-1-3-7-17/h1-11,16H,12-15H2 |
| InChIKey | MXFIWOYHQSHCOX-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone?
The IUPAC name of [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone (CID 46890991) is [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone.
What is the SMILES notation for [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone?
The canonical SMILES for [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone is O=C(c1ccccc1)N1CCN(c2nnc(-c3ccc(Cl)c(Cl)c3)c3ccccc23)CC1.
What is the InChIKey of [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone?
The InChIKey is MXFIWOYHQSHCOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H20Cl2N4O/c26-21-11-10-18(16-22(21)27)23-19-8-4-5-9-20(19)24(29-28-23)30-12-14-31(15-13-30)25(32)17-6-2-1-3-7-17/h1-11,16H,12-15H2.
What are the key properties of [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone?
[4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone has a molecular weight of 463.37 g/mol, XLogP of 5.57, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(3,4-dichlorophenyl)phthalazin-1-yl]piperazin-1-yl]-phenylmethanone is sourced from PubChem (CID 46890991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).