C34H42N4O7 — CID 46891138
ethyl 2-[[3-[[(2S)-3-cyclohexyl-2-[(1-methylindole-2-carbonyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate (PubChem CID 46891138) has the molecular formula C34H42N4O7 and a molecular weight of 618.73 g/mol. Its IUPAC name is ethyl 2-[[3-[[(2S)-3-cyclohexyl-2-[(1-methylindole-2-carbonyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate.
| Compound Name | ethyl 2-[[3-[[(2S)-3-cyclohexyl-2-[(1-methylindole-2-carbonyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate |
|---|---|
| PubChem CID | 46891138 |
| Molecular Formula | C34H42N4O7 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.31 |
| IUPAC Name | ethyl 2-[[3-[[(2S)-3-cyclohexyl-2-[(1-methylindole-2-carbonyl)amino]propanoyl]amino]-2-oxo-4-phenylmethoxybutanoyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)C(=O)C(COCc1ccccc1)NC(=O)[C@H](CC1CCCCC1)NC(=O)c1cc2ccccc2n1C |
| InChI | InChI=1S/C34H42N4O7/c1-3-45-30(39)20-35-34(43)31(40)27(22-44-21-24-14-8-5-9-15-24)37-32(41)26(18-23-12-6-4-7-13-23)36-33(42)29-19-25-16-10-11-17-28(25)38(29)2/h5,8-11,14-17,19,23,26-27H,3-4,6-7,12-13,18,20-22H2,1-2H3,(H,35,43)(H,36,42)(H,37,41)/t26-,27?/m0/s1 |
| InChIKey | VDMAZALTCXMGIT-QBHOUYDASA-N |
| XLogP | 3.20 |
| TPSA | 144.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|