C25H23N5O — CID 46891162
(S)-(2-methyl-4-(4-(pyridin-3-yl)phthalazin-1-yl)piperazin-1-yl)(phenyl)methanone (PubChem CID 46891162) has the molecular formula C25H23N5O and a molecular weight of 409.50 g/mol. Its IUPAC name is [(2S)-2-methyl-4-(4-pyridin-3-ylphthalazin-1-yl)piperazin-1-yl]-phenylmethanone.
| Compound Name | (S)-(2-methyl-4-(4-(pyridin-3-yl)phthalazin-1-yl)piperazin-1-yl)(phenyl)methanone |
|---|---|
| PubChem CID | 46891162 |
| Molecular Formula | C25H23N5O |
| Molecular Weight | 409.50 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | [(2S)-2-methyl-4-(4-pyridin-3-ylphthalazin-1-yl)piperazin-1-yl]-phenylmethanone |
| SMILES | C[C@H]1CN(CCN1C(=O)C2=CC=CC=C2)C3=NN=C(C4=CC=CC=C43)C5=CN=CC=C5 |
| InChI | InChI=1S/C25H23N5O/c1-18-17-29(14-15-30(18)25(31)19-8-3-2-4-9-19)24-22-12-6-5-11-21(22)23(27-28-24)20-10-7-13-26-16-20/h2-13,16,18H,14-15,17H2,1H3/t18-/m0/s1 |
| InChIKey | FURZQUUFGCPYIO-SFHVURJKSA-N |
| XLogP | 3.50 |
| TPSA | 62.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | 609 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |