C25H26F5NO5S2 — CID 46891343
2-[[(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]thiazinane 1,1-dioxide (PubChem CID 46891343) has the molecular formula C25H26F5NO5S2 and a molecular weight of 579.61 g/mol. Its IUPAC name is 2-[[(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]thiazinane 1,1-dioxide.
| Compound Name | 2-[[(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 46891343 |
| Molecular Formula | C25H26F5NO5S2 |
| Molecular Weight | 579.61 g/mol |
| Exact Mass | 579.12 |
| IUPAC Name | 2-[[(6aR,7R,10aS)-1,4-difluoro-10a-[4-(trifluoromethyl)phenyl]sulfonyl-6,6a,7,8,9,10-hexahydrobenzo[c]chromen-7-yl]methyl]thiazinane 1,1-dioxide |
| SMILES | O=S1(=O)CCCCN1C[C@@H]1CCC[C@@]2(S(=O)(=O)c3ccc(C(F)(F)F)cc3)c3c(F)ccc(F)c3OC[C@@H]12 |
| InChI | InChI=1S/C25H26F5NO5S2/c26-20-9-10-21(27)23-22(20)24(38(34,35)18-7-5-17(6-8-18)25(28,29)30)11-3-4-16(19(24)15-36-23)14-31-12-1-2-13-37(31,32)33/h5-10,16,19H,1-4,11-15H2/t16-,19-,24-/m0/s1 |
| InChIKey | SXXLRVACCAOMBW-UXSWERMXSA-N |
| XLogP | 4.89 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |