C26H26Cl3N3O2 — CID 46891372
6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-N-[(1R)-1-hydroxyethyl]-1,2,2-trimethyl-3,4-dihydro-1,8-naphthyridine-4-carboxamide (PubChem CID 46891372) has the molecular formula C26H26Cl3N3O2 and a molecular weight of 518.87 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-N-[(1R)-1-hydroxyethyl]-1,2,2-trimethyl-3,4-dihydro-1,8-naphthyridine-4-carboxamide.
| Compound Name | 6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-N-[(1R)-1-hydroxyethyl]-1,2,2-trimethyl-3,4-dihydro-1,8-naphthyridine-4-carboxamide |
|---|---|
| PubChem CID | 46891372 |
| Molecular Formula | C26H26Cl3N3O2 |
| Molecular Weight | 518.87 g/mol |
| Exact Mass | 517.11 |
| IUPAC Name | 6-(4-chlorophenyl)-7-(2,4-dichlorophenyl)-N-[(1R)-1-hydroxyethyl]-1,2,2-trimethyl-3,4-dihydro-1,8-naphthyridine-4-carboxamide |
| SMILES | C[C@@H](O)NC(=O)C1CC(C)(C)N(C)c2nc(-c3ccc(Cl)cc3Cl)c(-c3ccc(Cl)cc3)cc21 |
| InChI | InChI=1S/C26H26Cl3N3O2/c1-14(33)30-25(34)21-13-26(2,3)32(4)24-20(21)12-19(15-5-7-16(27)8-6-15)23(31-24)18-10-9-17(28)11-22(18)29/h5-12,14,21,33H,13H2,1-4H3,(H,30,34)/t14-,21?/m1/s1 |
| InChIKey | DIDXRIJBHXOGGD-CKAQCJTGSA-N |
| XLogP | 6.53 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.87 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|