About N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide
N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide (PubChem CID 46891395) has the molecular formula C8H4ClN3O3S2
and a molecular weight of 289.73 g/mol. Its IUPAC name is N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide |
| PubChem CID | 46891395 |
| Molecular Formula | C8H4ClN3O3S2 |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 288.94 |
| IUPAC Name | N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1nc(Cl)c([N+](=O)[O-])s1)c1cccs1 |
| InChI | InChI=1S/C8H4ClN3O3S2/c9-5-7(12(14)15)17-8(10-5)11-6(13)4-2-1-3-16-4/h1-3H,(H,10,11,13) |
| InChIKey | ZPTYJMSUNNGOPL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide?
The IUPAC name of N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide (CID 46891395) is N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide.
What is the SMILES notation for N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide?
The canonical SMILES for N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide is O=C(Nc1nc(Cl)c([N+](=O)[O-])s1)c1cccs1.
What is the InChIKey of N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide?
The InChIKey is ZPTYJMSUNNGOPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClN3O3S2/c9-5-7(12(14)15)17-8(10-5)11-6(13)4-2-1-3-16-4/h1-3H,(H,10,11,13).
What are the key properties of N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide?
N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide has a molecular weight of 289.73 g/mol, XLogP of 3.02, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chloro-5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide is sourced from PubChem (CID 46891395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).