C27H24F9N3O — CID 46891638
1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol (PubChem CID 46891638) has the molecular formula C27H24F9N3O and a molecular weight of 577.49 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
|---|---|
| PubChem CID | 46891638 |
| Molecular Formula | C27H24F9N3O |
| Molecular Weight | 577.49 g/mol |
| Exact Mass | 577.18 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[4-[4-[[4-[[6-(trifluoromethyl)-3-pyridinyl]methyl]piperazin-1-yl]methyl]phenyl]phenyl]propan-2-ol |
| SMILES | OC(c1ccc(-c2ccc(CN3CCN(Cc4ccc(C(F)(F)F)nc4)CC3)cc2)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C27H24F9N3O/c28-25(29,30)23-10-3-19(15-37-23)17-39-13-11-38(12-14-39)16-18-1-4-20(5-2-18)21-6-8-22(9-7-21)24(40,26(31,32)33)27(34,35)36/h1-10,15,40H,11-14,16-17H2 |
| InChIKey | YJKWVJPZMNRTSX-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.49 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |