C20H24N2O5 — CID 46891677
2-[benzyl-[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]ethyl]amino]acetic acid (PubChem CID 46891677) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-[benzyl-[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[benzyl-[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 46891677 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 2-[benzyl-[2-[carboxymethyl-[(2-hydroxyphenyl)methyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)Cc1ccccc1O)Cc1ccccc1 |
| InChI | InChI=1S/C20H24N2O5/c23-18-9-5-4-8-17(18)13-22(15-20(26)27)11-10-21(14-19(24)25)12-16-6-2-1-3-7-16/h1-9,23H,10-15H2,(H,24,25)(H,26,27) |
| InChIKey | JSDNXVMPVNBNSK-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|