C27H31F3N2O3 — CID 46891929
[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone (PubChem CID 46891929) has the molecular formula C27H31F3N2O3 and a molecular weight of 488.55 g/mol. Its IUPAC name is [(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone.
| Compound Name | [(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 46891929 |
| Molecular Formula | C27H31F3N2O3 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | [(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]-[(2S,4R)-4-phenyl-2-(2,2,2-trifluoroethyl)piperidin-1-yl]methanone |
| SMILES | COc1cccc2c1COC[C@]21CNC[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1CC(F)(F)F |
| InChI | InChI=1S/C27H31F3N2O3/c1-34-24-9-5-8-22-21(24)15-35-17-26(22)16-31-14-23(26)25(33)32-11-10-19(18-6-3-2-4-7-18)12-20(32)13-27(28,29)30/h2-9,19-20,23,31H,10-17H2,1H3/t19-,20+,23+,26-/m1/s1 |
| InChIKey | LVJRQUFLWXMWLR-ZNZMYEMYSA-N |
| XLogP | 4.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |