C33H44FN3O2 — CID 46892061
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-5-fluoro-8-propan-2-yloxyspiro[2,3-dihydro-1H-isoquinoline-4,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 46892061) has the molecular formula C33H44FN3O2 and a molecular weight of 533.73 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-5-fluoro-8-propan-2-yloxyspiro[2,3-dihydro-1H-isoquinoline-4,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-5-fluoro-8-propan-2-yloxyspiro[2,3-dihydro-1H-isoquinoline-4,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 46892061 |
| Molecular Formula | C33H44FN3O2 |
| Molecular Weight | 533.73 g/mol |
| Exact Mass | 533.34 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-5-fluoro-8-propan-2-yloxyspiro[2,3-dihydro-1H-isoquinoline-4,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | CC(C)Oc1ccc(F)c2c1CNC[C@]21CNC[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C33H44FN3O2/c1-22(2)39-30-14-13-28(34)31-26(30)18-35-20-33(31)21-36-19-27(33)32(38)37-16-15-25(23-9-5-3-6-10-23)17-29(37)24-11-7-4-8-12-24/h3,5-6,9-10,13-14,22,24-25,27,29,35-36H,4,7-8,11-12,15-21H2,1-2H3/t25-,27+,29+,33-/m1/s1 |
| InChIKey | RADWYJDWESCECG-WCOHXKSZSA-N |
| XLogP | 5.53 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.73 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |