C32H39F4N3O2 — CID 46892193
[(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-5-fluoro-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydro-1H-isoquinoline-4,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 46892193) has the molecular formula C32H39F4N3O2 and a molecular weight of 573.68 g/mol. Its IUPAC name is [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-5-fluoro-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydro-1H-isoquinoline-4,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-5-fluoro-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydro-1H-isoquinoline-4,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 46892193 |
| Molecular Formula | C32H39F4N3O2 |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | [(2S,4R)-2-cyclohexyl-4-phenylpiperidin-1-yl]-[(3'S,4S)-5-fluoro-8-(2,2,2-trifluoroethoxy)spiro[2,3-dihydro-1H-isoquinoline-4,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | O=C([C@@H]1CNC[C@]12CNCc1c(OCC(F)(F)F)ccc(F)c12)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C32H39F4N3O2/c33-26-11-12-28(41-20-32(34,35)36)24-16-37-18-31(29(24)26)19-38-17-25(31)30(40)39-14-13-23(21-7-3-1-4-8-21)15-27(39)22-9-5-2-6-10-22/h1,3-4,7-8,11-12,22-23,25,27,37-38H,2,5-6,9-10,13-20H2/t23-,25+,27+,31-/m1/s1 |
| InChIKey | SDZLUHMHXGLCKD-VWFCSTCUSA-N |
| XLogP | 5.68 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |