C31H38F2N2O3 — CID 46892197
[(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 46892197) has the molecular formula C31H38F2N2O3 and a molecular weight of 524.65 g/mol. Its IUPAC name is [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 46892197 |
| Molecular Formula | C31H38F2N2O3 |
| Molecular Weight | 524.65 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | COc1cccc2c1COC[C@]21CNC[C@H]1C(=O)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C31H38F2N2O3/c1-37-28-9-5-8-25-24(28)18-38-20-30(25)19-34-17-26(30)29(36)35-15-12-23(21-6-3-2-4-7-21)16-27(35)22-10-13-31(32,33)14-11-22/h2-9,22-23,26-27,34H,10-20H2,1H3/t23-,26+,27+,30-/m1/s1 |
| InChIKey | MYYVQWQOFYIKLC-PLTSLIBNSA-N |
| XLogP | 5.28 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |