C31H37F3N2O3 — CID 46892323
[(2S,4R)-2-(4,4-difluorocyclohexyl)-4-(2-fluorophenyl)piperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 46892323) has the molecular formula C31H37F3N2O3 and a molecular weight of 542.64 g/mol. Its IUPAC name is [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-(2-fluorophenyl)piperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-(2-fluorophenyl)piperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 46892323 |
| Molecular Formula | C31H37F3N2O3 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-(2-fluorophenyl)piperidin-1-yl]-[(3'S,4S)-8-methoxyspiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | COc1cccc2c1COC[C@]21CNC[C@H]1C(=O)N1CC[C@@H](c2ccccc2F)C[C@H]1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C31H37F3N2O3/c1-38-28-8-4-6-24-23(28)17-39-19-30(24)18-35-16-25(30)29(37)36-14-11-21(22-5-2-3-7-26(22)32)15-27(36)20-9-12-31(33,34)13-10-20/h2-8,20-21,25,27,35H,9-19H2,1H3/t21-,25+,27+,30-/m1/s1 |
| InChIKey | UQCDBGXICWIOBP-SZYSMEAISA-N |
| XLogP | 5.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |