C20H18FN5O — CID 46892374
2-[(4-fluorophenyl)-methoxymethyl]-N-(5-methyl-1H-pyrazol-3-yl)quinazolin-4-amine (PubChem CID 46892374) has the molecular formula C20H18FN5O and a molecular weight of 363.40 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)-methoxymethyl]-N-(5-methyl-1H-pyrazol-3-yl)quinazolin-4-amine.
| Compound Name | 2-[(4-fluorophenyl)-methoxymethyl]-N-(5-methyl-1H-pyrazol-3-yl)quinazolin-4-amine |
|---|---|
| PubChem CID | 46892374 |
| Molecular Formula | C20H18FN5O |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-[(4-fluorophenyl)-methoxymethyl]-N-(5-methyl-1H-pyrazol-3-yl)quinazolin-4-amine |
| SMILES | COC(c1ccc(F)cc1)c1nc(Nc2cc(C)[nH]n2)c2ccccc2n1 |
| InChI | InChI=1S/C20H18FN5O/c1-12-11-17(26-25-12)23-19-15-5-3-4-6-16(15)22-20(24-19)18(27-2)13-7-9-14(21)10-8-13/h3-11,18H,1-2H3,(H2,22,23,24,25,26) |
| InChIKey | AXVRJAHNPYGDTN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |