C31H39N3O5 — CID 46892481
ethyl 4-[3-[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-1-yl]benzoate (PubChem CID 46892481) has the molecular formula C31H39N3O5 and a molecular weight of 533.67 g/mol. Its IUPAC name is ethyl 4-[3-[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-1-yl]benzoate.
| Compound Name | ethyl 4-[3-[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-1-yl]benzoate |
|---|---|
| PubChem CID | 46892481 |
| Molecular Formula | C31H39N3O5 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | ethyl 4-[3-[2-[2,6-di(propan-2-yl)anilino]-2-oxoethyl]-2,4-dioxo-1,3-diazaspiro[4.5]decan-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)N(CC(=O)Nc3c(C(C)C)cccc3C(C)C)C(=O)C23CCCCC3)cc1 |
| InChI | InChI=1S/C31H39N3O5/c1-6-39-28(36)22-13-15-23(16-14-22)34-30(38)33(29(37)31(34)17-8-7-9-18-31)19-26(35)32-27-24(20(2)3)11-10-12-25(27)21(4)5/h10-16,20-21H,6-9,17-19H2,1-5H3,(H,32,35) |
| InChIKey | PYRZSSIZYWSOBY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|