C26H35BrClN3OS — CID 46892559
12-bromo-3-(5-chloropentyl)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-11-thia-3,4-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,12-tetraene-5-carboxamide (PubChem CID 46892559) has the molecular formula C26H35BrClN3OS and a molecular weight of 553.01 g/mol. Its IUPAC name is 12-bromo-3-(5-chloropentyl)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-11-thia-3,4-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,12-tetraene-5-carboxamide.
| Compound Name | 12-bromo-3-(5-chloropentyl)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-11-thia-3,4-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,12-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 46892559 |
| Molecular Formula | C26H35BrClN3OS |
| Molecular Weight | 553.01 g/mol |
| Exact Mass | 551.14 |
| IUPAC Name | 12-bromo-3-(5-chloropentyl)-N-[(6,6-dimethyl-2-bicyclo[3.1.1]heptanyl)methyl]-11-thia-3,4-diazatricyclo[8.3.0.02,6]trideca-1(10),2(6),4,12-tetraene-5-carboxamide |
| SMILES | CC1(C)C2CCC(CNC(=O)c3nn(CCCCCCl)c4c3CCCc3sc(Br)cc3-4)C1C2 |
| InChI | InChI=1S/C26H35BrClN3OS/c1-26(2)17-10-9-16(20(26)13-17)15-29-25(32)23-18-7-6-8-21-19(14-22(27)33-21)24(18)31(30-23)12-5-3-4-11-28/h14,16-17,20H,3-13,15H2,1-2H3,(H,29,32) |
| InChIKey | OHKGVRXTYSYTQY-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.01 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|