C32H37F5N2O3 — CID 46892588
[(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-(2,2,2-trifluoroethoxy)spiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone (PubChem CID 46892588) has the molecular formula C32H37F5N2O3 and a molecular weight of 592.65 g/mol. Its IUPAC name is [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-(2,2,2-trifluoroethoxy)spiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone.
| Compound Name | [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-(2,2,2-trifluoroethoxy)spiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone |
|---|---|
| PubChem CID | 46892588 |
| Molecular Formula | C32H37F5N2O3 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.27 |
| IUPAC Name | [(2S,4R)-2-(4,4-difluorocyclohexyl)-4-phenylpiperidin-1-yl]-[(3'S,4S)-8-(2,2,2-trifluoroethoxy)spiro[1,3-dihydroisochromene-4,4'-pyrrolidine]-3'-yl]methanone |
| SMILES | O=C([C@@H]1CNC[C@]12COCc1c(OCC(F)(F)F)cccc12)N1CC[C@@H](c2ccccc2)C[C@H]1C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C32H37F5N2O3/c33-31(34)12-9-22(10-13-31)27-15-23(21-5-2-1-3-6-21)11-14-39(27)29(40)26-16-38-18-30(26)19-41-17-24-25(30)7-4-8-28(24)42-20-32(35,36)37/h1-8,22-23,26-27,38H,9-20H2/t23-,26+,27+,30-/m1/s1 |
| InChIKey | LQZDUTOZPQIMKU-PLTSLIBNSA-N |
| XLogP | 6.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |