C21H23F6N5O — CID 46892692
6-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 46892692) has the molecular formula C21H23F6N5O and a molecular weight of 475.44 g/mol. Its IUPAC name is 6-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 46892692 |
| Molecular Formula | C21H23F6N5O |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | 6-[4-[4-(4,4,4-trifluorobutoxy)phenyl]piperidin-1-yl]-3-(trifluoromethyl)-7,8-dihydro-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | FC(F)(F)CCCOc1ccc(C2CCN(C3=Nn4c(nnc4C(F)(F)F)CC3)CC2)cc1 |
| InChI | InChI=1S/C21H23F6N5O/c22-20(23,24)10-1-13-33-16-4-2-14(3-5-16)15-8-11-31(12-9-15)18-7-6-17-28-29-19(21(25,26)27)32(17)30-18/h2-5,15H,1,6-13H2 |
| InChIKey | FTZMGJWJKRCFGP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 55.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|