About benzo[e][1,2]benzothiazole
benzo[e][1,2]benzothiazole (PubChem CID 46892800) has the molecular formula C11H7NS
and a molecular weight of 185.25 g/mol. Its IUPAC name is benzo[e][1,2]benzothiazole.
Molecular Properties
| Compound Name | benzo[e][1,2]benzothiazole |
| PubChem CID | 46892800 |
| Molecular Formula | C11H7NS |
| Molecular Weight | 185.25 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | benzo[e][1,2]benzothiazole |
| SMILES | c1ccc2c(c1)ccc1sncc12 |
| InChI | InChI=1S/C11H7NS/c1-2-4-9-8(3-1)5-6-11-10(9)7-12-13-11/h1-7H |
| InChIKey | XYKSABPYIZPLRX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze benzo[e][1,2]benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e][1,2]benzothiazole?
The IUPAC name of benzo[e][1,2]benzothiazole (CID 46892800) is benzo[e][1,2]benzothiazole.
What is the SMILES notation for benzo[e][1,2]benzothiazole?
The canonical SMILES for benzo[e][1,2]benzothiazole is c1ccc2c(c1)ccc1sncc12.
What is the InChIKey of benzo[e][1,2]benzothiazole?
The InChIKey is XYKSABPYIZPLRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NS/c1-2-4-9-8(3-1)5-6-11-10(9)7-12-13-11/h1-7H.
What are the key properties of benzo[e][1,2]benzothiazole?
benzo[e][1,2]benzothiazole has a molecular weight of 185.25 g/mol, XLogP of 3.45, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e][1,2]benzothiazole is sourced from PubChem (CID 46892800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).