C29H24F2N4O2 — CID 46892896
2-[7-[5-[bis(4-fluorophenyl)methyl]triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid (PubChem CID 46892896) has the molecular formula C29H24F2N4O2 and a molecular weight of 498.53 g/mol. Its IUPAC name is 2-[7-[5-[bis(4-fluorophenyl)methyl]triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid.
| Compound Name | 2-[7-[5-[bis(4-fluorophenyl)methyl]triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
|---|---|
| PubChem CID | 46892896 |
| Molecular Formula | C29H24F2N4O2 |
| Molecular Weight | 498.53 g/mol |
| Exact Mass | 498.19 |
| IUPAC Name | 2-[7-[5-[bis(4-fluorophenyl)methyl]triazol-1-yl]-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
| SMILES | O=C(O)Cc1c2n(c3ccccc13)CC(n1nncc1C(c1ccc(F)cc1)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C29H24F2N4O2/c30-20-9-5-18(6-10-20)29(19-7-11-21(31)12-8-19)27-16-32-33-35(27)22-13-14-26-24(15-28(36)37)23-3-1-2-4-25(23)34(26)17-22/h1-12,16,22,29H,13-15,17H2,(H,36,37) |
| InChIKey | XMQGBOWQHWIRFB-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.53 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|