C23H19F3N4O2 — CID 46892899
2-[7-[5-[(3,4-difluorophenyl)methyl]triazol-1-yl]-4-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid (PubChem CID 46892899) has the molecular formula C23H19F3N4O2 and a molecular weight of 440.43 g/mol. Its IUPAC name is 2-[7-[5-[(3,4-difluorophenyl)methyl]triazol-1-yl]-4-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid.
| Compound Name | 2-[7-[5-[(3,4-difluorophenyl)methyl]triazol-1-yl]-4-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
|---|---|
| PubChem CID | 46892899 |
| Molecular Formula | C23H19F3N4O2 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | 2-[7-[5-[(3,4-difluorophenyl)methyl]triazol-1-yl]-4-fluoro-6,7,8,9-tetrahydropyrido[1,2-a]indol-10-yl]acetic acid |
| SMILES | O=C(O)Cc1c2n(c3c(F)cccc13)CC(n1nncc1Cc1ccc(F)c(F)c1)CC2 |
| InChI | InChI=1S/C23H19F3N4O2/c24-18-6-4-13(9-20(18)26)8-15-11-27-28-30(15)14-5-7-21-17(10-22(31)32)16-2-1-3-19(25)23(16)29(21)12-14/h1-4,6,9,11,14H,5,7-8,10,12H2,(H,31,32) |
| InChIKey | KXXKIFZZDONZJD-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|