About (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol
(1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol (PubChem CID 46893044) has the molecular formula C19H15Cl2FN2O
and a molecular weight of 377.25 g/mol. Its IUPAC name is (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol.
Molecular Properties
| Compound Name | (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol |
| PubChem CID | 46893044 |
| Molecular Formula | C19H15Cl2FN2O |
| Molecular Weight | 377.25 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol |
| SMILES | N[C@@H](c1ccc(Cl)c(Cl)c1)[C@H](O)c1ccc(-c2cncc(F)c2)cc1 |
| InChI | InChI=1S/C19H15Cl2FN2O/c20-16-6-5-13(8-17(16)21)18(23)19(25)12-3-1-11(2-4-12)14-7-15(22)10-24-9-14/h1-10,18-19,25H,23H2/t18-,19+/m0/s1 |
| InChIKey | HZPVBIPJAUXCMZ-RBUKOAKNSA-N |
| XLogP | 4.93 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.25 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol?
The IUPAC name of (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol (CID 46893044) is (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol.
What is the SMILES notation for (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol?
The canonical SMILES for (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol is N[C@@H](c1ccc(Cl)c(Cl)c1)[C@H](O)c1ccc(-c2cncc(F)c2)cc1.
What is the InChIKey of (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol?
The InChIKey is HZPVBIPJAUXCMZ-RBUKOAKNSA-N. The full InChI is InChI=1S/C19H15Cl2FN2O/c20-16-6-5-13(8-17(16)21)18(23)19(25)12-3-1-11(2-4-12)14-7-15(22)10-24-9-14/h1-10,18-19,25H,23H2/t18-,19+/m0/s1.
What are the key properties of (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol?
(1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol has a molecular weight of 377.25 g/mol, XLogP of 4.93, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,2S)-2-amino-2-(3,4-dichlorophenyl)-1-[4-(5-fluoro-3-pyridinyl)phenyl]ethanol is sourced from PubChem (CID 46893044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).