C19H17NO5 — CID 4689309
5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-methylpyrrolidine-2,3-dione (PubChem CID 4689309) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-methylpyrrolidine-2,3-dione.
| Compound Name | 5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-methylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 4689309 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy(phenyl)methylidene]-1-methylpyrrolidine-2,3-dione |
| SMILES | COc1cc(C2C(=C(O)c3ccccc3)C(=O)C(=O)N2C)ccc1O |
| InChI | InChI=1S/C19H17NO5/c1-20-16(12-8-9-13(21)14(10-12)25-2)15(18(23)19(20)24)17(22)11-6-4-3-5-7-11/h3-10,16,21-22H,1-2H3 |
| InChIKey | RETHONMBFBCUJK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|