C19H15F2N5O — CID 46893385
[8-fluoro-4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-(4-fluorophenyl)methanol (PubChem CID 46893385) has the molecular formula C19H15F2N5O and a molecular weight of 367.36 g/mol. Its IUPAC name is [8-fluoro-4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-(4-fluorophenyl)methanol.
| Compound Name | [8-fluoro-4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-(4-fluorophenyl)methanol |
|---|---|
| PubChem CID | 46893385 |
| Molecular Formula | C19H15F2N5O |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | [8-fluoro-4-[(5-methyl-1H-pyrazol-3-yl)amino]quinazolin-2-yl]-(4-fluorophenyl)methanol |
| SMILES | Cc1cc(Nc2nc(C(O)c3ccc(F)cc3)nc3c(F)cccc23)n[nH]1 |
| InChI | InChI=1S/C19H15F2N5O/c1-10-9-15(26-25-10)22-18-13-3-2-4-14(21)16(13)23-19(24-18)17(27)11-5-7-12(20)8-6-11/h2-9,17,27H,1H3,(H2,22,23,24,25,26) |
| InChIKey | AARJXMFKCRRTBI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |