C27H27ClN2 — CID 46893506
13-chloro-2-[1-[(1S)-1-phenylethyl]piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene (PubChem CID 46893506) has the molecular formula C27H27ClN2 and a molecular weight of 414.98 g/mol. Its IUPAC name is 13-chloro-2-[1-[(1S)-1-phenylethyl]piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene.
| Compound Name | 13-chloro-2-[1-[(1S)-1-phenylethyl]piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
|---|---|
| PubChem CID | 46893506 |
| Molecular Formula | C27H27ClN2 |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | 13-chloro-2-[1-[(1S)-1-phenylethyl]piperidin-4-ylidene]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaene |
| SMILES | C[C@@H](c1ccccc1)N1CCC(=C2c3ccc(Cl)cc3CCc3cccnc32)CC1 |
| InChI | InChI=1S/C27H27ClN2/c1-19(20-6-3-2-4-7-20)30-16-13-21(14-17-30)26-25-12-11-24(28)18-23(25)10-9-22-8-5-15-29-27(22)26/h2-8,11-12,15,18-19H,9-10,13-14,16-17H2,1H3/t19-/m0/s1 |
| InChIKey | VOWLEUTUOQTSJA-IBGZPJMESA-N |
| XLogP | 6.49 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |