About 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide
2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide (PubChem CID 46894121) has the molecular formula C10H9BrN2O3
and a molecular weight of 285.10 g/mol. Its IUPAC name is 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide.
Molecular Properties
| Compound Name | 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide |
| PubChem CID | 46894121 |
| Molecular Formula | C10H9BrN2O3 |
| Molecular Weight | 285.10 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide |
| SMILES | NC(=O)CN1C(=O)OCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H9BrN2O3/c11-7-1-2-8-6(3-7)5-16-10(15)13(8)4-9(12)14/h1-3H,4-5H2,(H2,12,14) |
| InChIKey | GDYADFVTPPRKOM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.10 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide?
The IUPAC name of 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide (CID 46894121) is 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide.
What is the SMILES notation for 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide?
The canonical SMILES for 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide is NC(=O)CN1C(=O)OCc2cc(Br)ccc21.
What is the InChIKey of 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide?
The InChIKey is GDYADFVTPPRKOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O3/c11-7-1-2-8-6(3-7)5-16-10(15)13(8)4-9(12)14/h1-3H,4-5H2,(H2,12,14).
What are the key properties of 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide?
2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide has a molecular weight of 285.10 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-bromo-2-oxo-4H-3,1-benzoxazin-1-yl)acetamide is sourced from PubChem (CID 46894121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).