C21H36O — CID 46894185
[(1R,2S,3E,6Z,9Z)-1-methoxy-2,4,6-trimethylundeca-3,6,9-trienyl]cyclohexane (PubChem CID 46894185) has the molecular formula C21H36O and a molecular weight of 304.52 g/mol. Its IUPAC name is [(1R,2S,3E,6Z,9Z)-1-methoxy-2,4,6-trimethylundeca-3,6,9-trienyl]cyclohexane.
| Compound Name | [(1R,2S,3E,6Z,9Z)-1-methoxy-2,4,6-trimethylundeca-3,6,9-trienyl]cyclohexane |
|---|---|
| PubChem CID | 46894185 |
| Molecular Formula | C21H36O |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.28 |
| IUPAC Name | [(1R,2S,3E,6Z,9Z)-1-methoxy-2,4,6-trimethylundeca-3,6,9-trienyl]cyclohexane |
| SMILES | C/C=C\C/C=C(/C)C/C(C)=C/[C@H](C)[C@H](OC)C1CCCCC1 |
| InChI | InChI=1S/C21H36O/c1-6-7-9-12-17(2)15-18(3)16-19(4)21(22-5)20-13-10-8-11-14-20/h6-7,12,16,19-21H,8-11,13-15H2,1-5H3/b7-6-,17-12-,18-16+/t19-,21-/m0/s1 |
| InChIKey | YAHCQTKVJXWEMK-XHFOMUGLSA-N |
| XLogP | 6.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|